C12H11N5O4 — CID 64528846
3-[[4-(carbamoylamino)benzoyl]amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64528846) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-[[4-(carbamoylamino)benzoyl]amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[[4-(carbamoylamino)benzoyl]amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64528846 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-[[4-(carbamoylamino)benzoyl]amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | NC(=O)Nc1ccc(C(=O)Nc2cc(C(=O)O)[nH]n2)cc1 |
| InChI | InChI=1S/C12H11N5O4/c13-12(21)14-7-3-1-6(2-4-7)10(18)15-9-5-8(11(19)20)16-17-9/h1-5H,(H,19,20)(H3,13,14,21)(H2,15,16,17,18) |
| InChIKey | ILZPOKQMWLQONS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |