C9H6IN3O3S — CID 79685939
3-[(5-iodothiophene-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 79685939) has the molecular formula C9H6IN3O3S and a molecular weight of 363.14 g/mol. Its IUPAC name is 3-[(5-iodothiophene-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[(5-iodothiophene-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 79685939 |
| Molecular Formula | C9H6IN3O3S |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 3-[(5-iodothiophene-3-carbonyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(Nc1cc(C(=O)O)[nH]n1)c1csc(I)c1 |
| InChI | InChI=1S/C9H6IN3O3S/c10-6-1-4(3-17-6)8(14)11-7-2-5(9(15)16)12-13-7/h1-3H,(H,15,16)(H2,11,12,13,14) |
| InChIKey | GGNXZVNBLKMFGZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|