C10H8N4O2 — CID 79503844
N-(4-cyano-1H-pyrazol-5-yl)-3-methylfuran-2-carboxamide (PubChem CID 79503844) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 79503844 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1[nH]ncc1C#N |
| InChI | InChI=1S/C10H8N4O2/c1-6-2-3-16-8(6)10(15)13-9-7(4-11)5-12-14-9/h2-3,5H,1H3,(H2,12,13,14,15) |
| InChIKey | WBVTYXQNWFSJOR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |