C10H6ClN5O4S — CID 79497162
2-chloro-N-(4-cyano-1H-pyrazol-5-yl)-5-nitrobenzenesulfonamide (PubChem CID 79497162) has the molecular formula C10H6ClN5O4S and a molecular weight of 327.71 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 79497162 |
| Molecular Formula | C10H6ClN5O4S |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)-5-nitrobenzenesulfonamide |
| SMILES | N#Cc1cn[nH]c1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C10H6ClN5O4S/c11-8-2-1-7(16(17)18)3-9(8)21(19,20)15-10-6(4-12)5-13-14-10/h1-3,5H,(H2,13,14,15) |
| InChIKey | ZFZSNOYRAROGKD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|