C13H12Br2N2O2S — CID 80708249
2,5-dibromo-4-methyl-N-(3-methyl-4-pyridinyl)benzenesulfonamide (PubChem CID 80708249) has the molecular formula C13H12Br2N2O2S and a molecular weight of 420.13 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(3-methyl-4-pyridinyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(3-methyl-4-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 80708249 |
| Molecular Formula | C13H12Br2N2O2S |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(3-methyl-4-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2ccncc2C)cc1Br |
| InChI | InChI=1S/C13H12Br2N2O2S/c1-8-5-11(15)13(6-10(8)14)20(18,19)17-12-3-4-16-7-9(12)2/h3-7H,1-2H3,(H,16,17) |
| InChIKey | MFAMDSFEINOMMY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |