C14H12Br2INO2S — CID 81435963
2,5-dibromo-N-(4-iodo-2-methylphenyl)-4-methylbenzenesulfonamide (PubChem CID 81435963) has the molecular formula C14H12Br2INO2S and a molecular weight of 545.03 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-iodo-2-methylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(4-iodo-2-methylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81435963 |
| Molecular Formula | C14H12Br2INO2S |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 542.80 |
| IUPAC Name | 2,5-dibromo-N-(4-iodo-2-methylphenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2ccc(I)cc2C)cc1Br |
| InChI | InChI=1S/C14H12Br2INO2S/c1-8-6-12(16)14(7-11(8)15)21(19,20)18-13-4-3-10(17)5-9(13)2/h3-7,18H,1-2H3 |
| InChIKey | DBBYQHFYYIIWOW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|