C12H9Br2IN2O2S — CID 81326894
2,5-dibromo-N-(5-iodo-2-pyridinyl)-4-methylbenzenesulfonamide (PubChem CID 81326894) has the molecular formula C12H9Br2IN2O2S and a molecular weight of 532.00 g/mol. Its IUPAC name is 2,5-dibromo-N-(5-iodo-2-pyridinyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(5-iodo-2-pyridinyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81326894 |
| Molecular Formula | C12H9Br2IN2O2S |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 529.78 |
| IUPAC Name | 2,5-dibromo-N-(5-iodo-2-pyridinyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2ccc(I)cn2)cc1Br |
| InChI | InChI=1S/C12H9Br2IN2O2S/c1-7-4-10(14)11(5-9(7)13)20(18,19)17-12-3-2-8(15)6-16-12/h2-6H,1H3,(H,16,17) |
| InChIKey | LPZBKQZCJVWXCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|