C10H13N3O5S2 — CID 95390779
N'-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpyridine-4-carbohydrazide (PubChem CID 95390779) has the molecular formula C10H13N3O5S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is N'-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpyridine-4-carbohydrazide.
| Compound Name | N'-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 95390779 |
| Molecular Formula | C10H13N3O5S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N'-[(3R)-1,1-dioxothiolan-3-yl]sulfonylpyridine-4-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)[C@@H]1CCS(=O)(=O)C1)c1ccncc1 |
| InChI | InChI=1S/C10H13N3O5S2/c14-10(8-1-4-11-5-2-8)12-13-20(17,18)9-3-6-19(15,16)7-9/h1-2,4-5,9,13H,3,6-7H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | BPVFYBJIKBZRQH-SECBINFHSA-N |
| XLogP | -1.17 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|