C20H24N4O4S — CID 7371003
N-[(1R,2S)-2-methylcyclohexyl]-4-[(pyridine-4-carbonylamino)sulfamoyl]benzamide (PubChem CID 7371003) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-4-[(pyridine-4-carbonylamino)sulfamoyl]benzamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-4-[(pyridine-4-carbonylamino)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 7371003 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-4-[(pyridine-4-carbonylamino)sulfamoyl]benzamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)c1ccc(S(=O)(=O)NNC(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-14-4-2-3-5-18(14)22-19(25)15-6-8-17(9-7-15)29(27,28)24-23-20(26)16-10-12-21-13-11-16/h6-14,18,24H,2-5H2,1H3,(H,22,25)(H,23,26)/t14-,18+/m0/s1 |
| InChIKey | MUDPVQXQYDFFAQ-KBXCAEBGSA-N |
| XLogP | 2.01 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|