C9H13N5O — CID 167589522
2-N-(4-methoxypyrimidin-2-yl)-3-methyliminoprop-1-ene-1,2-diamine (PubChem CID 167589522) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-N-(4-methoxypyrimidin-2-yl)-3-methyliminoprop-1-ene-1,2-diamine.
| Compound Name | 2-N-(4-methoxypyrimidin-2-yl)-3-methyliminoprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 167589522 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-N-(4-methoxypyrimidin-2-yl)-3-methyliminoprop-1-ene-1,2-diamine |
| SMILES | C/N=C/C(=CN)Nc1nccc(OC)n1 |
| InChI | InChI=1S/C9H13N5O/c1-11-6-7(5-10)13-9-12-4-3-8(14-9)15-2/h3-6H,10H2,1-2H3,(H,12,13,14)/b7-5?,11-6+ |
| InChIKey | GQVIUHDKEHAATM-UHYUDDSYSA-N |
| XLogP | 0.40 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|