C9H13N3O3 — CID 55207180
ethyl 2-[(4-methoxypyrimidin-2-yl)amino]acetate (PubChem CID 55207180) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 2-[(4-methoxypyrimidin-2-yl)amino]acetate.
| Compound Name | ethyl 2-[(4-methoxypyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 55207180 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethyl 2-[(4-methoxypyrimidin-2-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nccc(OC)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-3-15-8(13)6-11-9-10-5-4-7(12-9)14-2/h4-5H,3,6H2,1-2H3,(H,10,11,12) |
| InChIKey | BCYWXPRBICASCP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |