C11H21N — CID 134400549
(1E,3Z)-3,4,7-trimethylocta-1,3-dien-1-amine (PubChem CID 134400549) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (1E,3Z)-3,4,7-trimethylocta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-3,4,7-trimethylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134400549 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (1E,3Z)-3,4,7-trimethylocta-1,3-dien-1-amine |
| SMILES | CC(/C=C/N)=C(\C)CCC(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2)5-6-10(3)11(4)7-8-12/h7-9H,5-6,12H2,1-4H3/b8-7+,11-10- |
| InChIKey | REJKOBBSUYIICS-LFOHPMNASA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|