C11H20 — CID 142183675
(Z,4Z)-4-ethylidene-7-methyloct-2-ene (PubChem CID 142183675) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-7-methyloct-2-ene.
| Compound Name | (Z,4Z)-4-ethylidene-7-methyloct-2-ene |
|---|---|
| PubChem CID | 142183675 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (Z,4Z)-4-ethylidene-7-methyloct-2-ene |
| SMILES | C/C=C\C(=C/C)CCC(C)C |
| InChI | InChI=1S/C11H20/c1-5-7-11(6-2)9-8-10(3)4/h5-7,10H,8-9H2,1-4H3/b7-5-,11-6+ |
| InChIKey | PQWNBZRAGBBJIO-LAVHUSFLSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|