C12H23N — CID 145367899
(Z,2E)-2-ethylidene-N-methyl-N-(2-methylpropyl)pent-3-en-1-amine (PubChem CID 145367899) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-N-methyl-N-(2-methylpropyl)pent-3-en-1-amine.
| Compound Name | (Z,2E)-2-ethylidene-N-methyl-N-(2-methylpropyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 145367899 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z,2E)-2-ethylidene-N-methyl-N-(2-methylpropyl)pent-3-en-1-amine |
| SMILES | C/C=C\C(=C/C)CN(C)CC(C)C |
| InChI | InChI=1S/C12H23N/c1-6-8-12(7-2)10-13(5)9-11(3)4/h6-8,11H,9-10H2,1-5H3/b8-6-,12-7+ |
| InChIKey | CLTKOMHMAPGZTQ-LQNKLOEDSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|