C11H15ClN2 — CID 143338895
2-[[(2E)-4-chloro-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-methylamino]acetonitrile (PubChem CID 143338895) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 2-[[(2E)-4-chloro-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-methylamino]acetonitrile.
| Compound Name | 2-[[(2E)-4-chloro-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-methylamino]acetonitrile |
|---|---|
| PubChem CID | 143338895 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[[(2E)-4-chloro-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-methylamino]acetonitrile |
| SMILES | C=C(Cl)/C=C(\C=C/C)CN(C)CC#N |
| InChI | InChI=1S/C11H15ClN2/c1-4-5-11(8-10(2)12)9-14(3)7-6-13/h4-5,8H,2,7,9H2,1,3H3/b5-4-,11-8+ |
| InChIKey | YUFXNHTYMCIDRT-LGXSBLIVSA-N |
| XLogP | 2.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|