C8H15N3O — CID 60677035
2-[cyanomethyl(methyl)amino]-N-propan-2-ylacetamide (PubChem CID 60677035) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-[cyanomethyl(methyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[cyanomethyl(methyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 60677035 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-[cyanomethyl(methyl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)CC#N |
| InChI | InChI=1S/C8H15N3O/c1-7(2)10-8(12)6-11(3)5-4-9/h7H,5-6H2,1-3H3,(H,10,12) |
| InChIKey | IXTPGZYNVLWHJV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|