C9H17N3O — CID 60670289
2-[1-cyanoethyl(methyl)amino]-N-propan-2-ylacetamide (PubChem CID 60670289) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[1-cyanoethyl(methyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[1-cyanoethyl(methyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 60670289 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-[1-cyanoethyl(methyl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)C(C)C#N |
| InChI | InChI=1S/C9H17N3O/c1-7(2)11-9(13)6-12(4)8(3)5-10/h7-8H,6H2,1-4H3,(H,11,13) |
| InChIKey | ZARKBQNWQUERMN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |