C10H20N4O3S — CID 86928405
2-[[2-cyanoethyl(methyl)sulfamoyl]-methylamino]-N-propan-2-ylacetamide (PubChem CID 86928405) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-[[2-cyanoethyl(methyl)sulfamoyl]-methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[2-cyanoethyl(methyl)sulfamoyl]-methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 86928405 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[[2-cyanoethyl(methyl)sulfamoyl]-methylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN(C)S(=O)(=O)N(C)CCC#N |
| InChI | InChI=1S/C10H20N4O3S/c1-9(2)12-10(15)8-14(4)18(16,17)13(3)7-5-6-11/h9H,5,7-8H2,1-4H3,(H,12,15) |
| InChIKey | YAKUJWASUPDFLI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |