C14H19ClN2O2 — CID 142907098
[(2S)-1-chloro-3-cyanopropan-2-yl] N-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamate (PubChem CID 142907098) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is [(2S)-1-chloro-3-cyanopropan-2-yl] N-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamate.
| Compound Name | [(2S)-1-chloro-3-cyanopropan-2-yl] N-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 142907098 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(2S)-1-chloro-3-cyanopropan-2-yl] N-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamate |
| SMILES | C=C(C)/C=C(\C=C/C)CNC(=O)O[C@H](CCl)CC#N |
| InChI | InChI=1S/C14H19ClN2O2/c1-4-5-12(8-11(2)3)10-17-14(18)19-13(9-15)6-7-16/h4-5,8,13H,2,6,9-10H2,1,3H3,(H,17,18)/b5-4-,12-8+/t13-/m0/s1 |
| InChIKey | IDNCRSFELSDFMG-XDZJLLIJSA-N |
| XLogP | 3.31 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|