C13H23N — CID 143109224
(Z,6Z)-N-ethenyl-6-ethylidenenon-7-en-2-amine (PubChem CID 143109224) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (Z,6Z)-N-ethenyl-6-ethylidenenon-7-en-2-amine.
| Compound Name | (Z,6Z)-N-ethenyl-6-ethylidenenon-7-en-2-amine |
|---|---|
| PubChem CID | 143109224 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (Z,6Z)-N-ethenyl-6-ethylidenenon-7-en-2-amine |
| SMILES | C=CNC(C)CCCC(/C=C\C)=C/C |
| InChI | InChI=1S/C13H23N/c1-5-9-13(6-2)11-8-10-12(4)14-7-3/h5-7,9,12,14H,3,8,10-11H2,1-2,4H3/b9-5-,13-6+ |
| InChIKey | CWINOAFOXMRVAX-PPYHSCCKSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|