C6H14N2 — CID 163535378
(2R)-2-N-ethenyl-1-N-methylpropane-1,2-diamine (PubChem CID 163535378) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (2R)-2-N-ethenyl-1-N-methylpropane-1,2-diamine.
| Compound Name | (2R)-2-N-ethenyl-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 163535378 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (2R)-2-N-ethenyl-1-N-methylpropane-1,2-diamine |
| SMILES | C=CN[C@H](C)CNC |
| InChI | InChI=1S/C6H14N2/c1-4-8-6(2)5-7-3/h4,6-8H,1,5H2,2-3H3/t6-/m1/s1 |
| InChIKey | DWMVIWNXZXNJET-ZCFIWIBFSA-N |
| XLogP | 0.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |