C7H14N2O — CID 141137546
4,5-bis(methylamino)pent-1-en-3-one (PubChem CID 141137546) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,5-bis(methylamino)pent-1-en-3-one.
| Compound Name | 4,5-bis(methylamino)pent-1-en-3-one |
|---|---|
| PubChem CID | 141137546 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4,5-bis(methylamino)pent-1-en-3-one |
| SMILES | C=CC(=O)C(CNC)NC |
| InChI | InChI=1S/C7H14N2O/c1-4-7(10)6(9-3)5-8-2/h4,6,8-9H,1,5H2,2-3H3 |
| InChIKey | WBEROJIXGXLNBZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|