C8H17NO3 — CID 87949090
1,1-dimethoxybut-3-en-2-one;N-methylmethanamine (PubChem CID 87949090) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1,1-dimethoxybut-3-en-2-one;N-methylmethanamine.
| Compound Name | 1,1-dimethoxybut-3-en-2-one;N-methylmethanamine |
|---|---|
| PubChem CID | 87949090 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1,1-dimethoxybut-3-en-2-one;N-methylmethanamine |
| SMILES | C=CC(=O)C(OC)OC.CNC |
| InChI | InChI=1S/C6H10O3.C2H7N/c1-4-5(7)6(8-2)9-3;1-3-2/h4,6H,1H2,2-3H3;3H,1-2H3 |
| InChIKey | XLSFCDJESMYNHN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|