C5H8Br2O3 — CID 87703915
1,1-dibromo-3,3-dimethoxypropan-2-one (PubChem CID 87703915) has the molecular formula C5H8Br2O3 and a molecular weight of 275.92 g/mol. Its IUPAC name is 1,1-dibromo-3,3-dimethoxypropan-2-one.
| Compound Name | 1,1-dibromo-3,3-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 87703915 |
| Molecular Formula | C5H8Br2O3 |
| Molecular Weight | 275.92 g/mol |
| Exact Mass | 273.88 |
| IUPAC Name | 1,1-dibromo-3,3-dimethoxypropan-2-one |
| SMILES | COC(OC)C(=O)C(Br)Br |
| InChI | InChI=1S/C5H8Br2O3/c1-9-5(10-2)3(8)4(6)7/h4-5H,1-2H3 |
| InChIKey | OMRHVVMIJAMTBA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.92 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|