About (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one
(4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one (PubChem CID 135368669) has the molecular formula C7H13BrO2
and a molecular weight of 209.08 g/mol. Its IUPAC name is (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one |
| PubChem CID | 135368669 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one |
| SMILES | CO[C@@H](Br)C(C)(C)C(C)=O |
| InChI | InChI=1S/C7H13BrO2/c1-5(9)7(2,3)6(8)10-4/h6H,1-4H3/t6-/m1/s1 |
| InChIKey | JYLGRIMJAQYRBT-ZCFIWIBFSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one?
The IUPAC name of (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one (CID 135368669) is (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one.
What is the SMILES notation for (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one?
The canonical SMILES for (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one is CO[C@@H](Br)C(C)(C)C(C)=O.
What is the InChIKey of (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one?
The InChIKey is JYLGRIMJAQYRBT-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13BrO2/c1-5(9)7(2,3)6(8)10-4/h6H,1-4H3/t6-/m1/s1.
What are the key properties of (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one?
(4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one has a molecular weight of 209.08 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-bromo-4-methoxy-3,3-dimethylbutan-2-one is sourced from PubChem (CID 135368669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).