C7H12O4 — CID 104539617
5,5-dimethoxypentane-2,3-dione (PubChem CID 104539617) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 5,5-dimethoxypentane-2,3-dione.
| Compound Name | 5,5-dimethoxypentane-2,3-dione |
|---|---|
| PubChem CID | 104539617 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 5,5-dimethoxypentane-2,3-dione |
| SMILES | COC(CC(=O)C(C)=O)OC |
| InChI | InChI=1S/C7H12O4/c1-5(8)6(9)4-7(10-2)11-3/h7H,4H2,1-3H3 |
| InChIKey | YLGVONFAIGRLPB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|