C7H13NO4 — CID 142475817
2-(hydroxymethylidene)-4,4-dimethoxybutanamide (PubChem CID 142475817) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(hydroxymethylidene)-4,4-dimethoxybutanamide.
| Compound Name | 2-(hydroxymethylidene)-4,4-dimethoxybutanamide |
|---|---|
| PubChem CID | 142475817 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-(hydroxymethylidene)-4,4-dimethoxybutanamide |
| SMILES | COC(CC(=CO)C(N)=O)OC |
| InChI | InChI=1S/C7H13NO4/c1-11-6(12-2)3-5(4-9)7(8)10/h4,6,9H,3H2,1-2H3,(H2,8,10) |
| InChIKey | DZKHWOIVXNMDIR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|