About 2-(hydroxymethylidene)-4,4-dimethoxybutanamide
2-(hydroxymethylidene)-4,4-dimethoxybutanamide (PubChem CID 142475817) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(hydroxymethylidene)-4,4-dimethoxybutanamide.
Molecular Properties
| Compound Name | 2-(hydroxymethylidene)-4,4-dimethoxybutanamide |
| PubChem CID | 142475817 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-(hydroxymethylidene)-4,4-dimethoxybutanamide |
| SMILES | COC(CC(=CO)C(N)=O)OC |
| InChI | InChI=1S/C7H13NO4/c1-11-6(12-2)3-5(4-9)7(8)10/h4,6,9H,3H2,1-2H3,(H2,8,10) |
| InChIKey | DZKHWOIVXNMDIR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethylidene)-4,4-dimethoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethylidene)-4,4-dimethoxybutanamide?
The IUPAC name of 2-(hydroxymethylidene)-4,4-dimethoxybutanamide (CID 142475817) is 2-(hydroxymethylidene)-4,4-dimethoxybutanamide.
What is the SMILES notation for 2-(hydroxymethylidene)-4,4-dimethoxybutanamide?
The canonical SMILES for 2-(hydroxymethylidene)-4,4-dimethoxybutanamide is COC(CC(=CO)C(N)=O)OC.
What is the InChIKey of 2-(hydroxymethylidene)-4,4-dimethoxybutanamide?
The InChIKey is DZKHWOIVXNMDIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-11-6(12-2)3-5(4-9)7(8)10/h4,6,9H,3H2,1-2H3,(H2,8,10).
What are the key properties of 2-(hydroxymethylidene)-4,4-dimethoxybutanamide?
2-(hydroxymethylidene)-4,4-dimethoxybutanamide has a molecular weight of 175.18 g/mol, XLogP of -0.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethylidene)-4,4-dimethoxybutanamide is sourced from PubChem (CID 142475817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).