C12H22O6 — CID 15677927
(3Z)-3-(hydroxymethylidene)-1,1,7,7-tetramethoxyheptan-4-one (PubChem CID 15677927) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (3Z)-3-(hydroxymethylidene)-1,1,7,7-tetramethoxyheptan-4-one.
| Compound Name | (3Z)-3-(hydroxymethylidene)-1,1,7,7-tetramethoxyheptan-4-one |
|---|---|
| PubChem CID | 15677927 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3Z)-3-(hydroxymethylidene)-1,1,7,7-tetramethoxyheptan-4-one |
| SMILES | COC(CCC(=O)/C(=C\O)CC(OC)OC)OC |
| InChI | InChI=1S/C12H22O6/c1-15-11(16-2)6-5-10(14)9(8-13)7-12(17-3)18-4/h8,11-13H,5-7H2,1-4H3/b9-8- |
| InChIKey | MIAPANWAAQOKHT-HJWRWDBZSA-N |
| XLogP | 1.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|