C16H30O5 — CID 11822796
(Z)-2-(4,4-dimethoxybutyl)-8,8-dimethoxyoct-2-enal (PubChem CID 11822796) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (Z)-2-(4,4-dimethoxybutyl)-8,8-dimethoxyoct-2-enal.
| Compound Name | (Z)-2-(4,4-dimethoxybutyl)-8,8-dimethoxyoct-2-enal |
|---|---|
| PubChem CID | 11822796 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (Z)-2-(4,4-dimethoxybutyl)-8,8-dimethoxyoct-2-enal |
| SMILES | COC(CCCC/C=C(\C=O)CCCC(OC)OC)OC |
| InChI | InChI=1S/C16H30O5/c1-18-15(19-2)11-7-5-6-9-14(13-17)10-8-12-16(20-3)21-4/h9,13,15-16H,5-8,10-12H2,1-4H3/b14-9- |
| InChIKey | CJZJSKHNLZUASK-ZROIWOOFSA-N |
| XLogP | 3.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|