C8H15IO3 — CID 25129059
(Z)-3-iodo-6,6-dimethoxyhex-2-en-1-ol (PubChem CID 25129059) has the molecular formula C8H15IO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is (Z)-3-iodo-6,6-dimethoxyhex-2-en-1-ol.
| Compound Name | (Z)-3-iodo-6,6-dimethoxyhex-2-en-1-ol |
|---|---|
| PubChem CID | 25129059 |
| Molecular Formula | C8H15IO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (Z)-3-iodo-6,6-dimethoxyhex-2-en-1-ol |
| SMILES | COC(CC/C(I)=C/CO)OC |
| InChI | InChI=1S/C8H15IO3/c1-11-8(12-2)4-3-7(9)5-6-10/h5,8,10H,3-4,6H2,1-2H3/b7-5- |
| InChIKey | YYRFFYQDVUVONC-ALCCZGGFSA-N |
| XLogP | 1.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|