C8H14N2O2 — CID 130238969
(Z)-2-amino-5,5-dimethoxy-3-methylpent-2-enenitrile (PubChem CID 130238969) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (Z)-2-amino-5,5-dimethoxy-3-methylpent-2-enenitrile.
| Compound Name | (Z)-2-amino-5,5-dimethoxy-3-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 130238969 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (Z)-2-amino-5,5-dimethoxy-3-methylpent-2-enenitrile |
| SMILES | COC(C/C(C)=C(\N)C#N)OC |
| InChI | InChI=1S/C8H14N2O2/c1-6(7(10)5-9)4-8(11-2)12-3/h8H,4,10H2,1-3H3/b7-6- |
| InChIKey | ZRQBDDGESLWCMK-SREVYHEPSA-N |
| XLogP | 0.75 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|