C8H13NO2 — CID 101226032
(Z)-5,5-dimethoxy-3-methylpent-2-enenitrile (PubChem CID 101226032) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (Z)-5,5-dimethoxy-3-methylpent-2-enenitrile.
| Compound Name | (Z)-5,5-dimethoxy-3-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 101226032 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (Z)-5,5-dimethoxy-3-methylpent-2-enenitrile |
| SMILES | COC(C/C(C)=C\C#N)OC |
| InChI | InChI=1S/C8H13NO2/c1-7(4-5-9)6-8(10-2)11-3/h4,8H,6H2,1-3H3/b7-4- |
| InChIKey | HYPMOQNCGJOCCY-DAXSKMNVSA-N |
| XLogP | 1.47 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|