C10H20O2 — CID 10583333
(E)-1,1-dimethoxy-3,4-dimethylhex-3-ene (PubChem CID 10583333) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (E)-1,1-dimethoxy-3,4-dimethylhex-3-ene.
| Compound Name | (E)-1,1-dimethoxy-3,4-dimethylhex-3-ene |
|---|---|
| PubChem CID | 10583333 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (E)-1,1-dimethoxy-3,4-dimethylhex-3-ene |
| SMILES | CC/C(C)=C(\C)CC(OC)OC |
| InChI | InChI=1S/C10H20O2/c1-6-8(2)9(3)7-10(11-4)12-5/h10H,6-7H2,1-5H3/b9-8+ |
| InChIKey | CSFULHJVOSLZPG-CMDGGOBGSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|