C9H18O — CID 123765053
2-methoxy-3,4-dimethylhex-3-ene (PubChem CID 123765053) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-methoxy-3,4-dimethylhex-3-ene.
| Compound Name | 2-methoxy-3,4-dimethylhex-3-ene |
|---|---|
| PubChem CID | 123765053 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2-methoxy-3,4-dimethylhex-3-ene |
| SMILES | CCC(C)=C(C)C(C)OC |
| InChI | InChI=1S/C9H18O/c1-6-7(2)8(3)9(4)10-5/h9H,6H2,1-5H3 |
| InChIKey | PUJGWRFWRPNATN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|