C9H16O — CID 91556490
4-methoxy-5-methylhepta-2,4-diene (PubChem CID 91556490) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 4-methoxy-5-methylhepta-2,4-diene.
| Compound Name | 4-methoxy-5-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 91556490 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 4-methoxy-5-methylhepta-2,4-diene |
| SMILES | CC=CC(OC)=C(C)CC |
| InChI | InChI=1S/C9H16O/c1-5-7-9(10-4)8(3)6-2/h5,7H,6H2,1-4H3 |
| InChIKey | ZQIBBSVVUHPQMC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|