C11H21NO2 — CID 167217123
(2Z,4Z)-3-(methoxymethoxy)-N-propylhexa-2,4-dien-2-amine (PubChem CID 167217123) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (2Z,4Z)-3-(methoxymethoxy)-N-propylhexa-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-3-(methoxymethoxy)-N-propylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 167217123 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (2Z,4Z)-3-(methoxymethoxy)-N-propylhexa-2,4-dien-2-amine |
| SMILES | C/C=C\C(OCOC)=C(/C)NCCC |
| InChI | InChI=1S/C11H21NO2/c1-5-7-11(14-9-13-4)10(3)12-8-6-2/h5,7,12H,6,8-9H2,1-4H3/b7-5-,11-10- |
| InChIKey | LFNZBZWVSWBFMT-YLRXWAGNSA-N |
| XLogP | 2.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|