C13H23IO3 — CID 11057339
1-[(E)-1-iodo-4,4-dimethoxy-2-methylbut-1-enyl]cyclohexan-1-ol (PubChem CID 11057339) has the molecular formula C13H23IO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 1-[(E)-1-iodo-4,4-dimethoxy-2-methylbut-1-enyl]cyclohexan-1-ol.
| Compound Name | 1-[(E)-1-iodo-4,4-dimethoxy-2-methylbut-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11057339 |
| Molecular Formula | C13H23IO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-[(E)-1-iodo-4,4-dimethoxy-2-methylbut-1-enyl]cyclohexan-1-ol |
| SMILES | COC(C/C(C)=C(/I)C1(O)CCCCC1)OC |
| InChI | InChI=1S/C13H23IO3/c1-10(9-11(16-2)17-3)12(14)13(15)7-5-4-6-8-13/h11,15H,4-9H2,1-3H3/b12-10+ |
| InChIKey | DEXRGMHZYZZFOD-ZRDIBKRKSA-N |
| XLogP | 3.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|