C9H16NO3P — CID 131667764
4-diethoxyphosphoryl-3-methyl(1,2-13C2)but-2-enenitrile (PubChem CID 131667764) has the molecular formula C9H16NO3P and a molecular weight of 219.19 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-3-methyl(1,2-13C2)but-2-enenitrile.
| Compound Name | 4-diethoxyphosphoryl-3-methyl(1,2-13C2)but-2-enenitrile |
|---|---|
| PubChem CID | 131667764 |
| Molecular Formula | C9H16NO3P |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-diethoxyphosphoryl-3-methyl(1,2-13C2)but-2-enenitrile |
| SMILES | CCOP(=O)(CC(C)=[13CH][13C]#N)OCC |
| InChI | InChI=1S/C9H16NO3P/c1-4-12-14(11,13-5-2)8-9(3)6-7-10/h6H,4-5,8H2,1-3H3/i6+1,7+1 |
| InChIKey | OPUURRZDCJCVGT-AKZCFXPHSA-N |
| XLogP | 2.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|