C10H13N — CID 59464759
CID 59464759 (PubChem CID 59464759) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol.
| Compound Name | CID 59464759 |
|---|---|
| PubChem CID | 59464759 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | — |
| SMILES | [CH]/C(C)=C/CC/C(C)=C/C#N |
| InChI | InChI=1S/C10H13N/c1-9(2)5-4-6-10(3)7-8-11/h1,5,7H,4,6H2,2-3H3/b9-5-,10-7+ |
| InChIKey | GBTOTOMXSIPNLV-UXINQVNVSA-N |
| XLogP | 2.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|