C20H29N — CID 14631544
(2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenenitrile (PubChem CID 14631544) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenenitrile.
| Compound Name | (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenenitrile |
|---|---|
| PubChem CID | 14631544 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (2E,4E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaenenitrile |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C#N |
| InChI | InChI=1S/C20H29N/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h8-9,11,13-15H,6-7,10,12H2,1-5H3/b14-8+,18-11+,19-13+,20-15+ |
| InChIKey | LXHJOEMCSGWAHT-FKFCXIACSA-N |
| XLogP | 6.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|