About CID 59967777
CID 59967777 (PubChem CID 59967777) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol.
Molecular Properties
| Compound Name | CID 59967777 |
| PubChem CID | 59967777 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | — |
| SMILES | [CH]/C(C)=C/CCC(C)CC#N |
| InChI | InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h1,5,10H,4,6-7H2,2-3H3/b9-5- |
| InChIKey | FQPBJUZUGYGSQA-UITAMQMPSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59967777 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59967777?
The IUPAC name of CID 59967777 (CID 59967777) is not available.
What is the SMILES notation for CID 59967777?
The canonical SMILES for CID 59967777 is [CH]/C(C)=C/CCC(C)CC#N.
What is the InChIKey of CID 59967777?
The InChIKey is FQPBJUZUGYGSQA-UITAMQMPSA-N. The full InChI is InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h1,5,10H,4,6-7H2,2-3H3/b9-5-.
What are the key properties of CID 59967777?
CID 59967777 has a molecular weight of 149.24 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59967777 is sourced from PubChem (CID 59967777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).