C20H34N2 — CID 89052536
3,7-dimethyloct-6-enenitrile (PubChem CID 89052536) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enenitrile.
| Compound Name | 3,7-dimethyloct-6-enenitrile |
|---|---|
| PubChem CID | 89052536 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 3,7-dimethyloct-6-enenitrile |
| SMILES | CC(C)=CCCC(C)CC#N.CC(C)=CCCC(C)CC#N |
| InChI | InChI=1S/2C10H17N/c2*1-9(2)5-4-6-10(3)7-8-11/h2*5,10H,4,6-7H2,1-3H3 |
| InChIKey | HZURODDPFOSLAB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|