C13H24N2 — CID 11557534
(4S)-2-(dimethylamino)-4,8-dimethylnon-7-enenitrile (PubChem CID 11557534) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (4S)-2-(dimethylamino)-4,8-dimethylnon-7-enenitrile.
| Compound Name | (4S)-2-(dimethylamino)-4,8-dimethylnon-7-enenitrile |
|---|---|
| PubChem CID | 11557534 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (4S)-2-(dimethylamino)-4,8-dimethylnon-7-enenitrile |
| SMILES | CC(C)=CCC[C@H](C)CC(C#N)N(C)C |
| InChI | InChI=1S/C13H24N2/c1-11(2)7-6-8-12(3)9-13(10-14)15(4)5/h7,12-13H,6,8-9H2,1-5H3/t12-,13?/m0/s1 |
| InChIKey | JPXBKVJYXCKAOY-UEWDXFNNSA-N |
| XLogP | 3.21 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|