C13H24O — CID 139824549
(2Z,4S,6R)-6,10-dimethylundeca-2,9-dien-4-ol (PubChem CID 139824549) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (2Z,4S,6R)-6,10-dimethylundeca-2,9-dien-4-ol.
| Compound Name | (2Z,4S,6R)-6,10-dimethylundeca-2,9-dien-4-ol |
|---|---|
| PubChem CID | 139824549 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2Z,4S,6R)-6,10-dimethylundeca-2,9-dien-4-ol |
| SMILES | C/C=C\[C@@H](O)C[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C13H24O/c1-5-7-13(14)10-12(4)9-6-8-11(2)3/h5,7-8,12-14H,6,9-10H2,1-4H3/b7-5-/t12-,13-/m1/s1 |
| InChIKey | QIWCWJCPQHLGMF-WFMXKNRHSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|