About (E)-2-methylhept-5-ene-1,4-diol
(E)-2-methylhept-5-ene-1,4-diol (PubChem CID 10606868) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is (E)-2-methylhept-5-ene-1,4-diol.
Molecular Properties
| Compound Name | (E)-2-methylhept-5-ene-1,4-diol |
| PubChem CID | 10606868 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (E)-2-methylhept-5-ene-1,4-diol |
| SMILES | C/C=C/C(O)CC(C)CO |
| InChI | InChI=1S/C8H16O2/c1-3-4-8(10)5-7(2)6-9/h3-4,7-10H,5-6H2,1-2H3/b4-3+ |
| InChIKey | KVHITMISPHQZPW-ONEGZZNKSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylhept-5-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylhept-5-ene-1,4-diol?
The IUPAC name of (E)-2-methylhept-5-ene-1,4-diol (CID 10606868) is (E)-2-methylhept-5-ene-1,4-diol.
What is the SMILES notation for (E)-2-methylhept-5-ene-1,4-diol?
The canonical SMILES for (E)-2-methylhept-5-ene-1,4-diol is C/C=C/C(O)CC(C)CO.
What is the InChIKey of (E)-2-methylhept-5-ene-1,4-diol?
The InChIKey is KVHITMISPHQZPW-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-4-8(10)5-7(2)6-9/h3-4,7-10H,5-6H2,1-2H3/b4-3+.
What are the key properties of (E)-2-methylhept-5-ene-1,4-diol?
(E)-2-methylhept-5-ene-1,4-diol has a molecular weight of 144.21 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylhept-5-ene-1,4-diol is sourced from PubChem (CID 10606868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).