C9H16O2 — CID 173315140
2-methylocta-1,6-diene-3,5-diol (PubChem CID 173315140) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-methylocta-1,6-diene-3,5-diol.
| Compound Name | 2-methylocta-1,6-diene-3,5-diol |
|---|---|
| PubChem CID | 173315140 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-methylocta-1,6-diene-3,5-diol |
| SMILES | C=C(C)C(O)CC(O)C=CC |
| InChI | InChI=1S/C9H16O2/c1-4-5-8(10)6-9(11)7(2)3/h4-5,8-11H,2,6H2,1,3H3 |
| InChIKey | WUIJXAYSHZRCJD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|