About pent-3-ene-1,2-diol;hydrochloride
pent-3-ene-1,2-diol;hydrochloride (PubChem CID 141276135) has the molecular formula C5H11ClO2
and a molecular weight of 138.59 g/mol. Its IUPAC name is pent-3-ene-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | pent-3-ene-1,2-diol;hydrochloride |
| PubChem CID | 141276135 |
| Molecular Formula | C5H11ClO2 |
| Molecular Weight | 138.59 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | pent-3-ene-1,2-diol;hydrochloride |
| SMILES | CC=CC(O)CO.Cl |
| InChI | InChI=1S/C5H10O2.ClH/c1-2-3-5(7)4-6;/h2-3,5-7H,4H2,1H3;1H |
| InChIKey | YBYDCEDLAICULJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.59 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-3-ene-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-ene-1,2-diol;hydrochloride?
The IUPAC name of pent-3-ene-1,2-diol;hydrochloride (CID 141276135) is pent-3-ene-1,2-diol;hydrochloride.
What is the SMILES notation for pent-3-ene-1,2-diol;hydrochloride?
The canonical SMILES for pent-3-ene-1,2-diol;hydrochloride is CC=CC(O)CO.Cl.
What is the InChIKey of pent-3-ene-1,2-diol;hydrochloride?
The InChIKey is YBYDCEDLAICULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.ClH/c1-2-3-5(7)4-6;/h2-3,5-7H,4H2,1H3;1H.
What are the key properties of pent-3-ene-1,2-diol;hydrochloride?
pent-3-ene-1,2-diol;hydrochloride has a molecular weight of 138.59 g/mol, XLogP of 0.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-ene-1,2-diol;hydrochloride is sourced from PubChem (CID 141276135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).