C5H12ClNO — CID 165429169
(E,2S)-2-aminopent-3-en-1-ol;hydrochloride (PubChem CID 165429169) has the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. Its IUPAC name is (E,2S)-2-aminopent-3-en-1-ol;hydrochloride.
| Compound Name | (E,2S)-2-aminopent-3-en-1-ol;hydrochloride |
|---|---|
| PubChem CID | 165429169 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (E,2S)-2-aminopent-3-en-1-ol;hydrochloride |
| SMILES | C/C=C/[C@H](N)CO.Cl |
| InChI | InChI=1S/C5H11NO.ClH/c1-2-3-5(6)4-7;/h2-3,5,7H,4,6H2,1H3;1H/b3-2+;/t5-;/m0./s1 |
| InChIKey | CRFAWQZYIFSIMG-XWEJTXOPSA-N |
| XLogP | 0.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|