About tert-butyl (3R)-3-aminohex-4-enoate
tert-butyl (3R)-3-aminohex-4-enoate (PubChem CID 2733827) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is tert-butyl (3R)-3-aminohex-4-enoate.
Molecular Properties
| Compound Name | tert-butyl (3R)-3-aminohex-4-enoate |
| PubChem CID | 2733827 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | tert-butyl (3R)-3-aminohex-4-enoate |
| SMILES | CC=C[C@H](N)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO2/c1-5-6-8(11)7-9(12)13-10(2,3)4/h5-6,8H,7,11H2,1-4H3/t8-/m0/s1 |
| InChIKey | LHUYXHJTMVKEOM-QMMMGPOBSA-N |
| XLogP | 1.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3R)-3-aminohex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-3-aminohex-4-enoate?
The IUPAC name of tert-butyl (3R)-3-aminohex-4-enoate (CID 2733827) is tert-butyl (3R)-3-aminohex-4-enoate.
What is the SMILES notation for tert-butyl (3R)-3-aminohex-4-enoate?
The canonical SMILES for tert-butyl (3R)-3-aminohex-4-enoate is CC=C[C@H](N)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (3R)-3-aminohex-4-enoate?
The InChIKey is LHUYXHJTMVKEOM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-6-8(11)7-9(12)13-10(2,3)4/h5-6,8H,7,11H2,1-4H3/t8-/m0/s1.
What are the key properties of tert-butyl (3R)-3-aminohex-4-enoate?
tert-butyl (3R)-3-aminohex-4-enoate has a molecular weight of 185.27 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-3-aminohex-4-enoate is sourced from PubChem (CID 2733827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).