C13H24N2O5S — CID 123359932
tert-butyl (3S)-3-amino-5-morpholin-4-ylsulfonylpent-4-enoate (PubChem CID 123359932) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-5-morpholin-4-ylsulfonylpent-4-enoate.
| Compound Name | tert-butyl (3S)-3-amino-5-morpholin-4-ylsulfonylpent-4-enoate |
|---|---|
| PubChem CID | 123359932 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl (3S)-3-amino-5-morpholin-4-ylsulfonylpent-4-enoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](N)C=CS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O5S/c1-13(2,3)20-12(16)10-11(14)4-9-21(17,18)15-5-7-19-8-6-15/h4,9,11H,5-8,10,14H2,1-3H3/t11-/m1/s1 |
| InChIKey | LCXUWIOQJBMYAV-LLVKDONJSA-N |
| XLogP | 0.22 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |